Feedback

meadowlactone

PropertiesImageOccurences in reactions
MNX_IDMNXM162505Image of MNXM162505
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC20H38O2
charge0
mass310.28718
referencechebi:132873
InChIKeyLLPDOHGLBDHCJZ-UHFFFAOYSA-N
InChIInChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(21)22-19/h19H,2-18H2,1H3
SMILESCCCCCCCCCCCCCCCC1CCCC(=O)O1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:132873
chebi:132873
meadowlactone
5-HETE 1,5-lactone
5-hydroxy-eicosatetraenoic acid 1,5-lactone
5-hydroxyicosatetraenoic acid 1,5-lactone
6-pentadecyloxan-2-one
Meadowfoam delta-lactone
delta-eicosalactone
delta-icosalactone