Feedback

(11S)-hydroperoxy-(9Z,12Z,15Z)-octadecatrienoate

PropertiesImageOccurences in reactions
MNX_IDMNXM163014Image of MNXM163014
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC18H29O4
charge-1
mass309.20713
referencechebi:134110
InChIKeyRYAKCZURVOCRAI-TYAFUOHSSA-M
InChIInChI=1S/C18H30O4/c1-2-3-4-8-11-14-17(22-21)15-12-9-6-5-7-10-13-16-18(19)20/h3-4,11-12,14-15,17,21H,2,5-10,13,16H2,1H3,(H,19,20)/p-1/b4-3-,14-11-,15-12-/t17-/m1/s1
SMILESCC/C=C\C/C=C\[C@H](/C=C\CCCCCCCC(=O)[O-])OO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:134110
chebi:134110
(11S)-hydroperoxy-(9Z,12Z,15Z)-octadecatrienoate
(9Z,11S,12Z,15Z)-11-hydroperoxyoctadeca-9,12,15-trienoate
(9Z,11S,12Z,15Z)-11-hydroperoxyoctadecatrienoate
11(S)-HPOTE(1-)
11(S)-HPOTrE(1-)
CHEBI:136686
chebi:136686
(9Z,11S,12Z,15Z)-11-hydroperoxyoctadecatrienoic acid
(11S)-hydroperoxy-(9Z,12Z,15Z)-octadecatrienoic acid
(9Z,11S,12Z,15Z)-11-hydroperoxyoctadeca-9,12,15-trienoic acid
11(S)-HPOTrE