Feedback

(2S)-2-amino-3-butenoate

PropertiesImageOccurences in reactions
MNX_IDMNXM163031Image of MNXM163031
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC4H7NO2
charge0
mass101.04768
referencechebi:134467
InChIKeyRQVLGLPAZTUBKX-VKHMYHEASA-N
InChIInChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2-3H,1,5H2,(H,6,7)/t3-/m0/s1
SMILESC=C[C@H]([NH3+])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:134467
chebi:134467
(2S)-2-amino-3-butenoate
(2S)-2-amino-3-butenoic acid zwitterion
(2S)-2-azaniumylbut-3-enoate
L-vinylglycine zwitterion
CHEBI:43858
chebi:43858
L-vinylglycine
(2S)-2-amino-3-butenoic acid
(2S)-2-aminobut-3-enoic acid
Vinylglycine