Feedback

(9S,16S)-dihydroperoxy-(10E,12Z,14E)-octadecatrienoate

PropertiesImageOccurences in reactions
MNX_IDMNXM163057Image of MNXM163057
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC18H29O6
charge-1
mass341.19696
referencechebi:133991
InChIKeyMFVHQYMRUDEPIO-NYOLHIHQSA-M
InChIInChI=1S/C18H30O6/c1-2-16(23-21)12-8-6-7-10-14-17(24-22)13-9-4-3-5-11-15-18(19)20/h6-8,10,12,14,16-17,21-22H,2-5,9,11,13,15H2,1H3,(H,19,20)/p-1/b7-6-,12-8+,14-10+/t16-,17-/m0/s1
SMILESCC[C@@H](/C=C/C=C\C=C\[C@H](CCCCCCCC(=O)[O-])OO)OO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:133991
chebi:133991
(9S,16S)-dihydroperoxy-(10E,12Z,14E)-octadecatrienoate
(10E,12Z,14E)-(9S,16S)-9,16-dihydroperoxyoctadeca-10,12,14-trienoate
(9S,10E,12Z,14E,16S)-9,16-bis(hydroperoxy)octadeca-10,12,14-trienoate
(9S,10E,12Z,14E,16S)-9,16-bis(hydroperoxy)octadecatrienoate
9S,16S-DiHPOTrE (1-)
CHEBI:133990
chebi:133990
(9S,10E,12Z,14E,16S)-9,16-bis(hydroperoxy)octadecatrienoic acid
(10E,12Z,14E)-(9S,16S)-9,16-dihydroperoxyoctadeca-10,12,14-trienoic acid
(9S,10E,12Z,14E,16S)-9,16-bis(hydroperoxy)octadeca-10,12,14-trienoic acid
(9S,16S)-dihydroperoxy-(10E,12Z,14E)-octadecatrienoic acid
9S,16S-DiHPOTrE