Feedback

 

2,3-dihydrodipicolinate(2-)

Image of MNXM163139
Properties
MNX_IDMNXM163139
formulaC7H5NO4
charge-2
mass167.12
referencechebi:11421
InChIKeyUWOCFOFVIBZJGH-UHFFFAOYSA-L
InChIInChI=1S/C7H7NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-2,5H,3H2,(H,9,10)(H,11,12)/p-2
SMILES[O-]C(=O)C1CC=CC(=N1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 2,3-dihydrodipicolinate(2-) in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:23dhdp 2,3-Dihydrodipicolinate
chebi:11421 2,3-dihydrodipicolinate(2-)
2,3-dihydropyridine-2,6-dicarboxylate
UWOCFOFVIBZJGH-UHFFFAOYSA-L
chebi:48052 2,3-dihydrodipicolinic acid
2,3-dihydropyridine-2,6-dicarboxylic acid
UWOCFOFVIBZJGH-UHFFFAOYSA-N