Feedback

 

1,3-benzodioxole-5-carboxylic acid [2-[[[(3-fluorophenyl)-oxomethyl]hydrazinylidene]methyl]phenyl] ester

Image of MNXM177410
Properties
MNX_IDMNXM177410
formulaC22H15FN2O5
charge0
mass406.3633
referencechebi:121940
InChIKeyLYZYSDXWWKZWHH-WYMPLXKRSA-N
InChIInChI=1S/C22H15FN2O5/c23-17-6-3-5-14(10-17)21(26)25-24-12-16-4-1-2-7-18(16)30-22(27)15-8-9-19-20(11-15)29-13-28-19/h1-12H,13H2,(H,25,26)/b24-12+
SMILESFc1cccc(c1)C(=O)NN=Cc1ccccc1OC(=O)c1ccc2OCOc2c1

This chemical compound does not exist in my selection



Occurrences of 1,3-benzodioxole-5-carboxylic acid [2-[[[(3-fluorophenyl)-oxomethyl]hydrazinylidene]methyl]phenyl] ester in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:121940 1,3-benzodioxole-5-carboxylic acid [2-[[[(3-fluorophenyl)-oxomethyl]hydrazinylidene]methyl]phenyl] ester
LYZYSDXWWKZWHH-UHFFFAOYSA-N