Feedback

 

1,3-benzodioxole-5-carboxylic acid [[amino-(3-nitrophenyl)methylidene]amino] ester

Image of MNXM177411
Properties
MNX_IDMNXM177411
formulaC15H11N3O6
charge0
mass329.2643
referencechebi:120680
InChIKeyBEOZHZRIKWOEMV-UHFFFAOYSA-N
InChIInChI=1S/C15H11N3O6/c16-14(9-2-1-3-11(6-9)18(20)21)17-24-15(19)10-4-5-12-13(7-10)23-8-22-12/h1-7H,8H2,(H2,16,17)
SMILES[O-][N+](=O)c1cccc(c1)C(=N)NOC(=O)c1ccc2OCOc2c1

This chemical compound does not exist in my selection



Occurrences of 1,3-benzodioxole-5-carboxylic acid [[amino-(3-nitrophenyl)methylidene]amino] ester in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:120680 1,3-benzodioxole-5-carboxylic acid [[amino-(3-nitrophenyl)methylidene]amino] ester
BEOZHZRIKWOEMV-UHFFFAOYSA-N