Feedback

 

1,3-benzothiazol-2-yl-[4-(2-pyridinyl)-1-piperazinyl]methanone

Image of MNXM177414
Properties
MNX_IDMNXM177414
formulaC17H16N4OS
charge0
mass324.4
referencechebi:111198
InChIKeyGEOUZRZOLPSTCW-UHFFFAOYSA-N
InChIInChI=1S/C17H16N4OS/c22-17(16-19-13-5-1-2-6-14(13)23-16)21-11-9-20(10-12-21)15-7-3-4-8-18-15/h1-8H,9-12H2
SMILESO=C(N1CCN(CC1)c1ccccn1)c1nc2ccccc2s1

This chemical compound does not exist in my selection



Occurrences of 1,3-benzothiazol-2-yl-[4-(2-pyridinyl)-1-piperazinyl]methanone in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:111198 1,3-benzothiazol-2-yl-[4-(2-pyridinyl)-1-piperazinyl]methanone
GEOUZRZOLPSTCW-UHFFFAOYSA-N