Feedback

 

1,3-benzothiazole-6-carboxylic acid [2-(2-furanyl)-2-oxoethyl] ester

Image of MNXM177416
Properties
MNX_IDMNXM177416
formulaC14H9NO4S
charge0
mass287.291
referencechebi:116498
InChIKeyCYRQVRWWJMWVJF-UHFFFAOYSA-N
InChIInChI=1S/C14H9NO4S/c16-11(12-2-1-5-18-12)7-19-14(17)9-3-4-10-13(6-9)20-8-15-10/h1-6,8H,7H2
SMILESO=C(COC(=O)c1ccc2ncsc2c1)c1ccco1

This chemical compound does not exist in my selection



Occurrences of 1,3-benzothiazole-6-carboxylic acid [2-(2-furanyl)-2-oxoethyl] ester in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:116498 1,3-benzothiazole-6-carboxylic acid [2-(2-furanyl)-2-oxoethyl] ester
CYRQVRWWJMWVJF-UHFFFAOYSA-N