Feedback

 

1,3-benzothiazole-6-carboxylic acid [2-[(3,5-dichloro-4-methyl-2-pyridinyl)amino]-2-oxoethyl] ester

Image of MNXM177417
Properties
MNX_IDMNXM177417
formulaC16H11Cl2N3O3S
charge0
mass396.248
referencechebi:115683
InChIKeyOYOPYZXBHFJXPZ-UHFFFAOYSA-N
InChIInChI=1S/C16H11Cl2N3O3S/c1-8-10(17)5-19-15(14(8)18)21-13(22)6-24-16(23)9-2-3-11-12(4-9)25-7-20-11/h2-5,7H,6H2,1H3,(H,19,21,22)
SMILESCc1c(Cl)cnc(NC(=O)COC(=O)c2ccc3ncsc3c2)c1Cl

This chemical compound does not exist in my selection



Occurrences of 1,3-benzothiazole-6-carboxylic acid [2-[(3,5-dichloro-4-methyl-2-pyridinyl)amino]-2-oxoethyl] ester in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:115683 1,3-benzothiazole-6-carboxylic acid [2-[(3,5-dichloro-4-methyl-2-pyridinyl)amino]-2-oxoethyl] ester
OYOPYZXBHFJXPZ-UHFFFAOYSA-N