Feedback

 

1,3-bis(2-phenylethyl)thiourea

Image of MNXM177419
Properties
MNX_IDMNXM177419
formulaC17H20N2S
charge0
mass284.419
referencechebi:122066
InChIKeyHVCLISLMGLZZDM-UHFFFAOYSA-N
InChIInChI=1S/C17H20N2S/c20-17(18-13-11-15-7-3-1-4-8-15)19-14-12-16-9-5-2-6-10-16/h1-10H,11-14H2,(H2,18,19,20)
SMILESS=C(NCCc1ccccc1)NCCc1ccccc1

This chemical compound does not exist in my selection



Occurrences of 1,3-bis(2-phenylethyl)thiourea in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:122066 1,3-bis(2-phenylethyl)thiourea
HVCLISLMGLZZDM-UHFFFAOYSA-N