Feedback

 

1,3-bis(3-chlorophenyl)urea

Image of MNXM177420
Properties
MNX_IDMNXM177420
formulaC13H10Cl2N2O
charge0
mass281.137
referencechebi:120602
InChIKeyHMOUVTOOMLBCPQ-UHFFFAOYSA-N
InChIInChI=1S/C13H10Cl2N2O/c14-9-3-1-5-11(7-9)16-13(18)17-12-6-2-4-10(15)8-12/h1-8H,(H2,16,17,18)
SMILESClc1cccc(NC(=O)Nc2cccc(Cl)c2)c1

This chemical compound does not exist in my selection



Occurrences of 1,3-bis(3-chlorophenyl)urea in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:120602 1,3-bis(3-chlorophenyl)urea
HMOUVTOOMLBCPQ-UHFFFAOYSA-N