Feedback

 

1,3-di-(11E-octadecenoyl)-2-(10Z,13Z,16Z-docosatrienoyl)-sn-glycerol

Image of MNXM177525
Properties
MNX_IDMNXM177525
formulaC61H108O6
charge0
mass937.5066
referenceslm:000212266
InChIKeyRYQFOFCUQIDZOW-DDBZUCAVSA-N
InChIInChI=1S/C61H108O6/c1-4-7-10-13-16-19-22-25-28-29-30-31-34-37-40-43-46-49-52-55-61(64)67-58(56-65-59(62)53-50-47-44-41-38-35-32-26-23-20-17-14-11-8-5-2)57-66-60(63)54-51-48-45-42-39-36-33-27-24-21-18-15-12-9-6-3/h16,19-21,23-25,28,30-31,58H,4-15,17-18,22,26-27,29,32-57H2,1-3H3/b19-16-,23-20+,24-21+,28-25-,31-30-
SMILES[H]\C(CCCCCC)=C(\[H])CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC\C([H])=C(/[H])CCCCCC)OC(=O)CCCCCCCC\C([H])=C(\[H])C\C([H])=C(\[H])C\C([H])=C(\[H])CCCCC

This chemical compound does not exist in my selection



Occurrences of 1,3-di-(11E-octadecenoyl)-2-(10Z,13Z,16Z-docosatrienoyl)-sn-glycerol in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
slm:000212266 1,3-di-(11E-octadecenoyl)-2-(10Z,13Z,16Z-docosatrienoyl)-sn-glycerol
TG(18:1(11E)/22:3(10Z,13Z,16Z)/18:1(11E))
Triacylglycerol (18:1(11E)/22:3(10Z,13Z,16Z)/18:1(11E))