Feedback

 

1,3-di-(9Z-hexadecenoyl)-2-(9Z,12Z,15Z,18Z,21Z-tetracosapentaenoyl)-sn-glycerol

Image of MNXM178644
Properties
MNX_IDMNXM178644
formulaC59H100O6
charge0
mass905.4217
referenceslm:000188606
InChIKeyFZNMSQYYQIPGNP-RKHBFQNBSA-N
InChIInChI=1S/C59H100O6/c1-4-7-10-13-16-19-22-25-26-27-28-29-30-31-32-35-38-41-44-47-50-53-59(62)65-56(54-63-57(60)51-48-45-42-39-36-33-23-20-17-14-11-8-5-2)55-64-58(61)52-49-46-43-40-37-34-24-21-18-15-12-9-6-3/h7,10,16,19-21,23-26,28-29,31-32,56H,4-6,8-9,11-15,17-18,22,27,30,33-55H2,1-3H3/b10-7-,19-16-,23-20-,24-21-,26-25-,29-28-,32-31-
SMILES[H]\C(CC)=C(/[H])C\C([H])=C(\[H])C\C([H])=C(\[H])C\C([H])=C(\[H])C\C([H])=C(\[H])CCCCCCCC(=O)OC(COC(=O)CCCCCCC\C([H])=C(\[H])CCCCCC)COC(=O)CCCCCCC\C([H])=C(\[H])CCCCCC

This chemical compound does not exist in my selection



Occurrences of 1,3-di-(9Z-hexadecenoyl)-2-(9Z,12Z,15Z,18Z,21Z-tetracosapentaenoyl)-sn-glycerol in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
slm:000188606 1,3-di-(9Z-hexadecenoyl)-2-(9Z,12Z,15Z,18Z,21Z-tetracosapentaenoyl)-sn-glycerol
TG(16:1(9Z)/24:5(9Z,12Z,15Z,18Z,21Z)/16:1(9Z))
Triacylglycerol (16:1(9Z)/24:5(9Z,12Z,15Z,18Z,21Z)/16:1(9Z))