Feedback

 

1,3-di-(9Z-tetradecenoyl)-2-(10Z,13Z,16Z-docosatrienoyl)-sn-glycerol

Image of MNXM178680
Properties
MNX_IDMNXM178680
formulaC53H92O6
charge0
mass825.294
referenceslm:000143316
InChIKeyVQNHLDASPFKXJB-MOSGBEDGSA-N
InChIInChI=1S/C53H92O6/c1-4-7-10-13-16-19-22-23-24-25-26-27-28-29-32-35-38-41-44-47-53(56)59-50(48-57-51(54)45-42-39-36-33-30-20-17-14-11-8-5-2)49-58-52(55)46-43-40-37-34-31-21-18-15-12-9-6-3/h14-19,23-24,26-27,50H,4-13,20-22,25,28-49H2,1-3H3/b17-14-,18-15-,19-16-,24-23-,27-26-
SMILES[H]\C(CCCC)=C(/[H])CCCCCCCC(=O)OCC(COC(=O)CCCCCCC\C([H])=C(\[H])CCCC)OC(=O)CCCCCCCC\C([H])=C(\[H])C\C([H])=C(\[H])C\C([H])=C(\[H])CCCCC

This chemical compound does not exist in my selection



Occurrences of 1,3-di-(9Z-tetradecenoyl)-2-(10Z,13Z,16Z-docosatrienoyl)-sn-glycerol in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
slm:000143316 1,3-di-(9Z-tetradecenoyl)-2-(10Z,13Z,16Z-docosatrienoyl)-sn-glycerol
TG(14:1(9Z)/22:3(10Z,13Z,16Z)/14:1(9Z))
Triacylglycerol (14:1(9Z)/22:3(10Z,13Z,16Z)/14:1(9Z))