Feedback

1-(11E-octadecenoyl)-2-(9Z-octadecenoyl)-sn-glycero-3-phosphocholine

PropertiesImageOccurences in reactions
MNX_IDMNXM192005Image of MNXM192005
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC44H84NO8P
charge0
mass786.113461
referenceslm:000008054
InChIKeyFOECFSINPHCSNE-IDAVMBLWSA-N
InChIInChI=1S/C44H84NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(46)50-40-42(41-52-54(48,49)51-39-38-45(3,4)5)53-44(47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h16,18,21,23,42H,6-15,17,19-20,22,24-41H2,1-5H3/b18-16+,23-21-/t42-/m1/s1
SMILESCCCCCCCC\C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC\C=C\CCCCCC)COP([O-])(=O)OCC[N+](C)(C)C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
SLM:000008054
slm:000008054
1-(11E-octadecenoyl)-2-(9Z-octadecenoyl)-sn-glycero-3-phosphocholine
PC(18:1(11E)/18:1(9Z))
Phosphatidylcholine (18:1(11E)/18:1(9Z))