Feedback

1-(11E-octadecenoyl)-2-(9Z-tetradecenoyl)-3-(9Z-tetradecenoyl)-sn-glycerol

PropertiesImageOccurences in reactions
MNX_IDMNXM192042Image of MNXM192042
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC49H88O6
charge0
mass773.21942
referenceslm:000130838
InChIKeyAZXHNJLLQHJYIJ-NEORFIDDSA-N
InChIInChI=1S/C49H88O6/c1-4-7-10-13-16-19-22-23-24-25-28-30-33-36-39-42-48(51)54-45-46(55-49(52)43-40-37-34-31-27-21-18-15-12-9-6-3)44-53-47(50)41-38-35-32-29-26-20-17-14-11-8-5-2/h14-15,17-19,22,46H,4-13,16,20-21,23-45H2,1-3H3/b17-14-,18-15-,22-19+/t46-/m0/s1
SMILESCCCCCC\C=C\CCCCCCCCCC(=O)OC[C@H](COC(=O)CCCCCCC\C=C/CCCC)OC(=O)CCCCCCC\C=C/CCCC
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
SLM:000130838
slm:000130838
1-(11E-octadecenoyl)-2-(9Z-tetradecenoyl)-3-(9Z-tetradecenoyl)-sn-glycerol
TG(18:1(11E)/14:1(9Z)/14:1(9Z))
Triacylglycerol (18:1(11E)/14:1(9Z)/14:1(9Z))