This is version 4.2 of MetaNetX/MNXref
 Feedback

2-oxoglutarate

PropertiesImageOccurences in reactions
MNX_IDMNXM20Image of MNXM20
#reac
in my sandbox 0
in MNXref (generic)914
in models (compartimentalized) 283
formulaC5H4O5
charge-2
mass144.08226
referencechebi:16810
InChIKeyKPGXRSRHYNQIFN-UHFFFAOYSA-L
InChIInChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)/p-2
SMILES[O-]C(=O)CCC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113594
reactomeM:R-ALL-113594
reactome:R-ALL-113671
reactomeM:R-ALL-113671
reactome:R-ALL-1650779
reactomeM:R-ALL-1650779
reactome:R-ALL-29406
reactomeM:R-ALL-29406
reactome:R-ALL-389537
reactomeM:R-ALL-389537
reactome:R-ALL-561075
reactomeM:R-ALL-561075
CHEBI:16810
chebi:16810
2-oxoglutarate
2-ketoglutarate
2-oxoglutarate(2-)
2-oxopentanedioate
2-oxopentanedioic acid, ion(2-)
alpha-ketoglutarate
bigg.metabolite:akg
biggM:akg
envipath:...fb79b4e697f5
envipathM:...fb79b4e697f5
2-Oxoglutarate
sabiork.compound:1922
sabiorkM:1922
2-Oxoglutarate
2-Ketoglutarate
2-Ketoglutaric acid
Oxoglutaric acid
alpha-Ketoglutarate
alpha-Ketoglutaric acid
seed.compound:cpd00024
seedM:cpd00024
2-Oxoglutarate
2-Ketoglutaric acid
2-ketoglutarate
2-ketoglutaric acid
2-oxoglutarate
2-oxoglutaric acid
2-oxopentanedionate
2-oxopentanedionic acid
Oxoglutaric acid
a-ketoglutaric acid
akg
alpha-Ketoglutaric acid
alpha-ketoglutarate
alpha-ketoglutaric acid
alpha-oxoglutarate
ketoglutarate
kegg.compound:C00026
keggC:C00026
2-Oxoglutarate
2-Ketoglutaric acid
Oxoglutaric acid
alpha-Ketoglutaric acid
CHEBI:30916
chebi:30916
2-oxoglutarate(1-)
2-ketoglutarate
4-carboxy-2-oxobutanoate
metacyc.compound:2-KETOGLUTARATE
metacycM:2-KETOGLUTARATE
2-oxoglutarate
2-ketoglutarate
2-ketoglutaric acid
2-oxoglutaric acid
2-oxopentanedionate
2-oxopentanedionic acid
a-ketoglutaric acid
alpha-ketoglutarate
alpha-ketoglutaric acid
alpha-oxoglutarate
ketoglutarate
CHEBI:30915
chebi:30915
2-oxoglutaric acid
2-Ketoglutaric acid
2-oxopentanedioic acid
Oxoglutaric acid
alpha-Ketoglutaric acid
alpha-ketoglutaric acid
hmdb:HMDB0000208 Oxoglutaric acid
2-Ketoglutarate
2-Ketoglutaric acid
2-Oxoglutarate
2-Oxoglutaric acid
2-Oxopentanedioate
2-Oxopentanedioic acid
2-oxo-1,5-Pentanedioate
2-oxo-1,5-Pentanedioic acid
2-oxopentanedioic acid
Calcium alpha-ketoglutarate
Calcium ketoglutarate
Oxoglutarate
a-Ketoglutarate
a-Ketoglutaric acid
alpha-Ketoglutarate
alpha-Ketoglutaric acid
alpha-Ketoglutaric acid, calcium salt (2:1)
alpha-Ketoglutaric acid, diammonium salt
alpha-Ketoglutaric acid, dipotassium salt
alpha-Ketoglutaric acid, disodium salt
alpha-Ketoglutaric acid, monopotassium salt
alpha-Ketoglutaric acid, monosodium salt
alpha-Ketoglutaric acid, potassium salt
alpha-Ketoglutaric acid, sodium salt
alpha-Oxoglutarate
alpha-ketoglutarate
alpha-ketoglutaric acid
oxoglutarate
envipath:...8ce0eae788a9
envipathM:...8ce0eae788a9
compound 974
hmdb:HMDB0002812
hmdb:HMDB00208
hmdb:HMDB02812
chebi:11638
chebi:1253
chebi:19748
chebi:19749
chebi:40661
biggM:M_akg
keggC:M_C00026
seedM:M_cpd00024
secondary/obsolete/fantasy identifier