Feedback

benzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM217Image of MNXM217
#reac
in my sandbox 0
in MNXref (generic)62
in models (compartimentalized) 34
formulaC7H5O2
charge-1
mass121.0295
referencechebi:16150
InChIKeyWPYMKLBDIGXBTP-UHFFFAOYSA-M
InChIInChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1
SMILESO=C([O-])c1ccccc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16150
chebi:16150
benzoate
Benzenecarboxylate
Benzeneformate
Benzenemethanoate
Phenylcarboxylate
Phenylformate
benzoate anion
benzoic acid, ion(1-)
kegg.compound:C00539
keggC:C00539
Aromatic acid
Aromatic carboxylic acid
bigg.metabolite:bz
biggM:bz
envipath:...63ac4d9d4d4f
envipathM:...63ac4d9d4d4f
Benzoate
seed.compound:cpd00153
seedM:cpd00153
Benzoate
Aromatic acid
Aromatic carboxylic acid
Benzenecarboxylic acid
Benzoic acid
Dracylic acid
Phenylformic acid
benzenecarboxylic acid
benzoate
benzoic acid
bz
phenylformic acid
sabiork.compound:1912
sabiorkM:1912
Benzoate
Benzenecarboxylic acid
Benzoic acid
Dracylic acid
Phenyl formate
Phenylformic acid
kegg.compound:C00180
keggC:C00180
Benzoate
Benzenecarboxylic acid
Benzoic acid
Dracylic acid
Phenylformic acid
kegg.drug:D00038
keggD:D00038
Benzoic acid (JP18/USP)
Benzoic acid (TN)
hmdb:HMDB0001870 Benzoic acid
Acid, benzoic
Acide benzoique
Aromatic carboxylate
Aromatic carboxylic acid
Benzenecarboxylate
Benzenecarboxylic acid
Benzeneformate
Benzeneformic acid
Benzenemethanoate
Benzenemethanoic acid
Benzenemethonic acid
Benzoate
Benzoate, potassium
Benzoesaeure
Benzoic acid sodium salt
Carboxybenzene
Diacylate
Diacylic acid
Dracylate
Dracylic acid
Kendall brand OF benzoic acid sodium salt
Oracylic acid
Phenylcarboxylate
Phenylcarboxylic acid
Phenylformate
Phenylformic acid
Potassium benzoate
Sodium benzoate
Sodium benzoic acid
Ucephan
benzoic acid
e210
metacyc.compound:BENZOATE
metacycM:BENZOATE
benzoate
benzenecarboxylic acid
benzoic acid
phenylformic acid
reactome:R-ALL-159446
reactomeM:R-ALL-159446
CHEBI:30746
chebi:30746
benzoic acid
Aromatic carboxylic acid
BENZOIC ACID
Benzenecarboxylic acid
Benzeneformic acid
Benzenemethanoic acid
Benzoesaeure
Benzoic acid
Dracylic acid
E210
Phenylcarboxylic acid
Phenylformic acid
acide benzoique
envipath:...d98fd864baf2
envipathM:...d98fd864baf2
compound 126
envipath:...fcfde47d1d15
envipathM:...fcfde47d1d15
compound 37916
hmdb:HMDB01870
chebi:13879
chebi:22717
chebi:22722
chebi:3029
chebi:41051
biggM:M_bz
keggC:M_C00180
keggC:M_C00539
keggD:M_D00038
seedM:M_cpd00153
secondary/obsolete/fantasy identifier