Feedback

(3Z)-4-(2-carboxyphenyl)-2-oxobut-3-enoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2577Image of MNXM2577
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC11H6O5
charge-2
mass218.16234
referencechebi:58794
InChIKeyAPKXMKWCGDBYNV-WAYWQWQTSA-L
InChIInChI=1S/C11H8O5/c12-9(11(15)16)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H,(H,13,14)(H,15,16)/p-2/b6-5-
SMILES[O-]C(=O)C(=O)\C=C/c1ccccc1C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58794
chebi:58794
(3Z)-4-(2-carboxyphenyl)-2-oxobut-3-enoate
(3Z)-4-(2-carboxyphenyl)-2-oxobut-3-enoate(2-)
2-[(1Z)-3-carboxylato-3-oxoprop-1-en-1-yl]benzoate
kegg.compound:C16149
keggC:C16149
(3Z)-4-(2-Carboxyphenyl)-2-oxobut-3-enoate
cis-2'-Carboxybenzalpyruvate
CHEBI:49222
chebi:49222
(3Z)-4-(2-carboxyphenyl)-2-oxobut-3-enoic acid
(3Z)-4-(2-Carboxyphenyl)-2-oxobut-3-enoate
2-[(1Z)-3-carboxy-3-oxoprop-1-en-1-yl]benzoic acid
cis-2'-Carboxybenzalpyruvate
seed.compound:cpd14870
seedM:cpd14870
cis-2'-Carboxybenzalpyruvate
(3Z)-4-(2-Carboxyphenyl)-2-oxobut-3-enoate
keggC:M_C16149
seedM:M_cpd14870
secondary/obsolete/fantasy identifier