Feedback

(7S,8S,9Z,12Z)-7,8-dihydroxyoctadeca-9,12-dienoate

Properties
MNX_IDMNXM2956
formulaC18H31O4
charge-1
mass311.43634
referencechebi:57468
Image of MNXM2956
InChIKeyNMONGVDUESEHOK-MPOZZNMKSA-M
InChIInChI=1S/C18H32O4/c1-2-3-4-5-6-7-8-10-13-16(19)17(20)14-11-9-12-15-18(21)22/h6-7,10,13,16-17,19-20H,2-5,8-9,11-12,14-15H2,1H3,(H,21,22)/p-1/b7-6-,13-10-/t16-,17-/m0/s1
SMILESCCCCC\C=C/C\C=C/[C@H](O)[C@@H](O)CCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:57468 (7S,8S,9Z,12Z)-7,8-dihydroxyoctadeca-9,12-dienoate
7(S),8(S)-DiHODE anion
7(S),8(S)-DiHODE(1-)
chebi:15658 7(S),8(S)-DiHODE
(7S,8S)-DiHODE
(7S,8S)-dihydroxylinoleic acid
(7S,8S,9Z,12Z)-7,8-dihydroxyoctadeca-9,12-dienoic acid
(9Z,12Z)-(7S,8S)-Dihydroxyoctadeca-9,12-dienoate
(9Z,12Z)-(7S,8S)-Dihydroxyoctadeca-9,12-dienoic acid
chebi:10944
chebi:267
keggC:M_C07354
seedM:M_cpd04554
secondary/obsolete/fantasy identifier
keggC:C07354 (7S,8S)-DiHODE
(7S,8S,9Z,12Z)-7,8-Dihydroxyoctadeca-9,12-dienoate
(9Z,12Z)-(7S,8S)-Dihydroxyoctadeca-9,12-dienoic acid
lipidmaps:LMFA02000224 7S,8S-DiHODE
(9Z,12Z)-(7S,8S)-Dihydroxyoctadeca-9,12-dienoic acid
7,8-DiHODE
7S,8S-dihydroxy-9Z,12Z-octadecadienoic acid
FA(18:2(OH2))
seedM:cpd04554 (7S,8S)-DiHODE
(7S,8S,9Z,12Z)-7,8-Dihydroxyoctadeca-9,12-dienoate
(9Z,12Z)-(7S,8S)-Dihydroxyoctadeca-9,12-dienoate
(9Z,12Z)-(7S,8S)-Dihydroxyoctadeca-9,12-dienoic acid