Feedback

(2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3122Image of MNXM3122
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC12H10NO4
charge-1
mass232.21214
referencechebi:60885
InChIKeyAFPIGEHQFVBSJA-ACIWFXKJSA-M
InChIInChI=1S/C12H11NO4/c13-9-5-2-1-4-8(9)10(14)6-3-7-11(15)12(16)17/h1-7,15H,13H2,(H,16,17)/p-1/b6-3+,11-7+
SMILESNc1ccccc1C(=O)\C=C\C=C(\O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:60885
chebi:60885
(2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate
(E,E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoate
CHEBI:61027
chebi:61027
(2E,4E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid
(E,E)-6-(2-aminophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid