|
![]() |
InChIKey | NBAZIIRGURJZJA-LBPRGKRZSA-N |
InChI | InChI=1S/C15H13I2NO7S/c16-10-5-8(6-12(18)15(19)20)1-3-13(10)24-9-2-4-14(11(17)7-9)25-26(21,22)23/h1-5,7,12H,6,18H2,(H,19,20)(H,21,22,23)/t12-/m0/s1 |
SMILES | N[C@@H](Cc1ccc(Oc2ccc(OS(O)(=O)=O)c(I)c2)c(I)c1)C(O)=O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 2 |
Distinct compatimentalized reactions in models | 2 |
Identifier | Description |
---|---|
biggM:CE2870 | 3,3'-diiodo-L-thyronine 4'-O-sulfate |
biggM:M_CE2870 | secondary/obsolete/fantasy identifier |
chebi:35431 reactome:R-ALL-176519 | 3,3'-diiodo-L-thyronine sulfate 3,3'-T2 sulfate 3,3'-T2S 3,3'-diiodothyronine-4-sulfate 3-iodo-O-[3-iodo-4-(sulfooxy)phenyl]-L-tyrosine |
MNXM164192 | is deprecated and replaced by this entry |
MNXM90390 | is deprecated and replaced by this entry |