Feedback

 

THF-L-glutamate

Image of MNXM317
Properties
MNX_IDMNXM317
formulaC29H34N9O12
charge-3
mass700.635
referenceseed:cpd06227
InChIKeyRXWVHRYZTWZATH-XSLAGTTESA-K
InChIInChI=1S/C29H37N9O12/c30-29-37-23-22(25(44)38-29)33-15(12-32-23)11-31-14-3-1-13(2-4-14)24(43)36-18(28(49)50)6-9-20(40)34-16(26(45)46)5-8-19(39)35-17(27(47)48)7-10-21(41)42/h1-4,15-18,31,33H,5-12H2,(H,34,40)(H,35,39)(H,36,43)(H,41,42)(H,45,46)(H,47,48)(H,49,50)(H4,30,32,37,38,44)/p-3/t15-,16-,17-,18-/m0/s1
SMILES[H][C@@](CCC([O-])=[NH+][C@@]([H])(CCC([O-])=[NH+][C@@]([H])(CCC([O-])=O)C([O-])=O)C([O-])=O)(NC(=O)c1ccc(NC[C@@]2([H])CNc3[nH]c(=[NH2+])[nH+]c([O-])c3N2)cc1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of THF-L-glutamate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB06825 2-{4-[(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)formamido]-4-carboxybutanamido}pentanedioic acid
2-{4-[(4-{[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methyl]amino}phenyl)formamido]-4-carboxybutanamido}pentanedioic acid
Tetrahydrofolyl-[Glu](2)
kegg:C09332 (6S)-H4PteGlu2
THF-L-glutamate
Tetrahydropteroyldiglutamate
metacyc:CPD-17108 CPD-17108
H4PteGlu2
tetrahydropteroyl di-L-glutamate
seed:cpd06227 THF-L-glutamate
THF-polyglutamate
Tetrahydrofolyl-[Glu](2)
Tetrahydrofolyl-[Glu](n)
Tetrahydrofolyl-[Glu](n+1)
Tetrahydropteroyl-[gamma-Glu]n
Tetrahydropteroyl-[gamma-Glu]n+1
thfglu
seed:cpd19097 THF-L-glutamate
Tetrahydrofolyl-[Glu](2)
tetrahydrofolate glutamate