Feedback

5-hydroxyimidazole-4-acetate

PropertiesImageOccurences in reactions
MNX_IDMNXM3189Image of MNXM3189
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC5H5N2O3
charge-1
mass141.10488
referencechebi:58565
InChIKeyYHUKSLQXRSAEOH-UHFFFAOYSA-M
InChIInChI=1S/C5H6N2O3/c8-4(9)1-3-5(10)7-2-6-3/h2,10H,1H2,(H,6,7)(H,8,9)/p-1
SMILES[O-]C(=O)Cc1[nH+]c[nH]c1[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58565
chebi:58565
5-hydroxyimidazole-4-acetate
(5-hydroxy-1H-imidazol-4-yl)acetate
CHEBI:28416
chebi:28416
5-hydroxyimidazole-4-acetic acid
(5-hydroxy-1H-imidazol-4-yl)acetic acid
chebi:12131
chebi:18587
chebi:236
secondary/obsolete/fantasy identifier