Feedback

crepenynate

PropertiesImageOccurences in reactions
MNX_IDMNXM3242Image of MNXM3242
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC18H29O2
charge-1
mass277.42166
referencechebi:14030
InChIKeySAOSKFBYQJLQOS-KTKRTIGZSA-M
InChIInChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-5,8,11-17H2,1H3,(H,19,20)/p-1/b10-9-
SMILESCCCCCC#CC\C=C/CCCCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:14030
chebi:14030
crepenynate
(9Z)-Octadec-9-en-12-ynoate
(9Z)-octadec-9-en-12-ynoate
(Z)-9-octadecen-12-ynoate
Crepenynate
cis-9-octadecen-12-ynoate
CHEBI:16423
chebi:16423
(9Z)-octadec-9-en-12-ynoic acid
(Z)-9-Octadecen-12-ynoic acid
(Z)-octadec-9-en-12-ynoic acid
9c12a-18:2
Crepenynic acid
Crepenynsaeure
cis-9-Octadecen-12-ynoic acid
cis-Octadec-9-en-12-in-1-saeure
seed.compound:cpd04503
seedM:cpd04503
Crepenynate
(9Z)-Octadec-9-en-12-ynoate
(9Z)-octadec-9-en-12-ynoate
(Z)-9-Octadecen-12-ynoic acid
(Z)-9-octadecen-12-ynoic acid
Crepenynic acid
crepenynate
crepenynic acid
kegg.compound:C07289
keggC:C07289
Crepenynate
(9Z)-Octadec-9-en-12-ynoate
(Z)-9-Octadecen-12-ynoic acid
Crepenynic acid
lipidmaps:LMFA01030742
lipidmapsM:LMFA01030742
Crepenynic acid
9Z-Octadecen-12-ynoic acid
Crepeninic acid
FA(18:3)
metacyc.compound:CREPENYNATE
metacycM:CREPENYNATE
crepenynate
(9Z)-octadec-9-en-12-ynoate
(Z)-9-octadecen-12-ynoic acid
crepenynic acid
chebi:23407
chebi:3912
chebi:3913
keggC:M_C07289
seedM:M_cpd04503
secondary/obsolete/fantasy identifier