Feedback

2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3442Image of MNXM3442
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 1
formulaC14H9O8
charge-1
mass305.21646
referencechebi:57628
InChIKeyGRXIELRCPYIEQI-UHFFFAOYSA-M
InChIInChI=1S/C14H10O8/c15-7-4-10(18)12(13(19)20)11(5-7)22-14(21)6-1-2-8(16)9(17)3-6/h1-5,15-18H,(H,19,20)/p-1
SMILESOc1cc(O)c(C([O-])=O)c(OC(=O)c2ccc(O)c(O)c2)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57628
chebi:57628
2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate
2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate anion
2-Protocatechoylphloroglucinolcarboxylate
bigg.metabolite:2pcpgc
biggM:2pcpgc
2 Protocatechoylphloroglucinolcarboxylate
hmdb:HMDB0059651 2-(3,4-Dihydroxybenzoyloxy)-4,6-dihydroxybenzoate
2,4DIOH-6(2,4Diohbenacid)benzacid
2-(3,4-Dihydroxybenzoyloxy)-4,6-dihydroxybenzoic acid
2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoic acid
2-Protocatechoylphloroglucinolcarboxylate
2-Protocatechoylphloroglucinolcarboxylic acid
2-Protocatechuoyl phloroglucinolcarboxylate
2-Protocatechuoyl phloroglucinolcarboxylic acid
CHEBI:16068
chebi:16068
2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoic acid
2,4DiOH-6(2,4DiOHBenAcid)BenzAcid
2-(3,4-Dihydroxybenzoyloxy)-4,6-dihydroxybenzoate
2-Protocatechuoyl phloroglucinolcarboxylate
2PCPGCA
envipath:...5ccfa7563211
envipathM:...5ccfa7563211
2-Protocatechoylphloroglucinolcarboxylate
sabiork.compound:7373
sabiorkM:7373
kegg.compound:C04524
keggC:C04524
2-Protocatechoylphloroglucinolcarboxylate
2-(3,4-Dihydroxybenzoyloxy)-4,6-dihydroxybenzoate
seed.compound:cpd02754
seedM:cpd02754
2-Protocatechoylphloroglucinolcarboxylate
2-(3,4-Dihydroxybenzoyloxy)-4,6-dihydroxybenzoate
2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate
2-protocatechuoyl-phloroglucinol carboxylic acid
2-protocatechuoylphloroglucinolcarboxylate
2pcpgc
metacyc.compound:2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA
metacycM:2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA
2-protocatechuoylphloroglucinolcarboxylate
2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate
2-protocatechuoyl-phloroglucinol carboxylic acid
hmdb:HMDB59651
chebi:11654
chebi:1273
chebi:136231
chebi:19773
biggM:M_2pcpgc
keggC:M_C04524
seedM:M_cpd02754
secondary/obsolete/fantasy identifier