Feedback

homogentisate

PropertiesImageOccurences in reactions
MNX_IDMNXM345Image of MNXM345
#reac
in my sandbox 0
in MNXref (generic)24
in models (compartimentalized) 18
formulaC8H7O4
charge-1
mass167.03498
referencechebi:16169
InChIKeyIGMNYECMUMZDDF-UHFFFAOYSA-M
InChIInChI=1S/C8H8O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1
SMILESO=C([O-])Cc1cc(O)ccc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-30337
reactomeM:R-ALL-30337
CHEBI:16169
chebi:16169
homogentisate
(2,5-dihydroxyphenyl)acetate
bigg.metabolite:hgentis
biggM:hgentis
envipath:...c39ba3e563bb
envipathM:...c39ba3e563bb
Homogentisate
seed.compound:cpd00426
seedM:cpd00426
Homogentisate
2,5-Dihydroxyphenylacetate
2,5-Dihydroxyphenylacetic acid
2,5-dihydroxyphenylacetate
Homogentisic acid
hgentis
homogentisate
sabiork.compound:5134
sabiorkM:5134
kegg.compound:C00544
keggC:C00544
Homogentisate
2,5-Dihydroxyphenylacetate
2,5-Dihydroxyphenylacetic acid
Homogentisic acid
hmdb:HMDB0000130 Homogentisic acid
(2,5-Dihydroxyphenyl)-acetate
(2,5-Dihydroxyphenyl)-acetic acid
2,5-Dihydroxy-a-toluate
2,5-Dihydroxy-a-toluic acid
2,5-Dihydroxy-alpha-toluate
2,5-Dihydroxy-alpha-toluic acid
2,5-Dihydroxy-benzeneacetate
2,5-Dihydroxy-benzeneacetic acid
2,5-Dihydroxyphenylacetate
2,5-Dihydroxyphenylacetic acid
2-(2,5-dihydroxyphenyl)acetic acid
2-(3,6-DIHYDROXYPHENYL)acetIC ACID
2-(3,6-DIHYDROXYPHENYL)acetate
Acid, homogentisic
Alcapton
Homogentisate
Homogentisate acid
Homogentisinate
Homogentisinic acid
Melanic acid
homogentisic acid
metacyc.compound:HOMOGENTISATE
metacycM:HOMOGENTISATE
homogentisate
2,5-dihydroxyphenylacetate
CHEBI:44747
chebi:44747
homogentisic acid
(2,5-dihydroxyphenyl)acetic acid
2,5-Dihydroxyphenylacetic acid
2-(3,6-DIHYDROXYPHENYL)ACETIC ACID
Homogentisic acid
hmdb:HMDB00130
chebi:11452
chebi:14410
chebi:24615
chebi:44744
chebi:5755
biggM:M_hgentis
keggC:M_C00544
seedM:M_cpd00426
secondary/obsolete/fantasy identifier