Feedback

(+-)-trans-acenaphthene-1,2-diol

PropertiesImageOccurences in reactions
MNX_IDMNXM3731Image of MNXM3731
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC12H10O2
charge0
mass186.2066
referencechebi:28395
InChIKeyARGFAPRYULRPAN-VXGBXAGGSA-N
InChIInChI=1S/C12H10O2/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)14/h1-6,11-14H/t11-,12-/m1/s1
SMILESO[C@H]1[C@H](O)c2cccc3cccc1c23
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:28395
chebi:28395
(+-)-trans-acenaphthene-1,2-diol
(+/-)-trans-Acenaphthene-1,2-diol
(+/-)-trans-acenaphthene-1,2-diol
rel-(1R,2R)-1,2-dihydroacenaphthylene-1,2-diol
trans-1,2-dihydro-1,2-acenaphthylenediol
chebi:11089
chebi:18467
chebi:71
secondary/obsolete/fantasy identifier