Feedback

26-hydroxycholesterol 3-sulfate

PropertiesImageOccurences in reactions
MNX_IDMNXM3827Image of MNXM3827
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC27H46O5S
charge0
mass482.3066
referencechebi:35419
InChIKeyQCSROMOVNFYJNF-CCDZVGGQSA-N
InChIInChI=1S/C27H46O5S/c1-18(17-28)6-5-7-19(2)23-10-11-24-22-9-8-20-16-21(32-33(29,30)31)12-14-26(20,3)25(22)13-15-27(23,24)4/h8,18-19,21-25,28H,5-7,9-17H2,1-4H3,(H,29,30,31)/t18?,19-,21+,22+,23-,24+,25+,26+,27-/m1/s1
SMILESCC(CO)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OS(=O)(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-176502
reactomeM:R-ALL-176502
CHEBI:35419
chebi:35419
26-hydroxycholesterol 3-sulfate
26-hydroxycholest-5-en-3beta-yl hydrogen sulfate
lipidmaps:LMST05020013
lipidmapsM:LMST05020013
26-hydroxycholesterol 3-sulfate
26-hydroxycholest-5-en-3beta-yl sulfate
O2
S
ST 27:1