Feedback

citronellic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM4528Image of MNXM4528
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC10H18O2
charge0
mass170.13068
referencechebi:80507
InChIKeyGJWSUKYXUMVMGX-UHFFFAOYSA-N
InChIInChI=1S/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12)
SMILESCC(C)=CCCC(C)CC(=O)O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:80507
chebi:80507
citronellic acid
3,7-dimethyl-6-octenoic acid
3,7-dimethyloct-6-enoic acid
rhodinic acid
rhodinolic acid
envipath:...0cafdb2e56f2
envipathM:...0cafdb2e56f2
Citronellate
seed.compound:cpd26734
seedM:cpd26734
Citronellates
seed.compound:cpd15166
seedM:cpd15166
kegg.compound:C16462
keggC:C16462
Citronellate
3,7-Dimethyl-6-octenoic acid
Citronellic acid
hmdb:HMDB0035837 Citronellic acid
3,7-Dimethyl-6-octenoate
3,7-Dimethyl-6-octenoic acid
3,7-dimethyloct-6-enoic acid
Callitrol
Citronellate
FEMA 3142
Rhodinic acid
Rhodinolic acid
citronellic acid
lipidmaps:LMFA01020104
lipidmapsM:LMFA01020104
Citronellic acid
3,7-dimethyl-6-octenoic acid
FA 10:1
Rhodinic acid
metacyc.compound:Citronellates
metacycM:Citronellates
citronellate
3,7-dimethyl-6-octenoic acid
citronellic acid
rhodinolic acid
hmdb:HMDB35837
keggC:M_C16462
seedM:M_cpd15166
seedM:M_cpd26734
secondary/obsolete/fantasy identifier