Feedback

 

2-(3,4,5-trimethoxyphenyl)acetic acid

Image of MNXM471291
Properties
MNX_IDMNXM471291
formulaC11H13O5
charge-1
mass225.2185
referencechebi:125676
InChIKeyDDSJXCGGOXKGSJ-UHFFFAOYSA-M
InChIInChI=1S/C11H14O5/c1-14-8-4-7(6-10(12)13)5-9(15-2)11(8)16-3/h4-5H,6H2,1-3H3,(H,12,13)/p-1
SMILESCOc1cc(CC([O-])=O)cc(OC)c1OC

This chemical compound does not exist in my selection



Occurrences of 2-(3,4,5-trimethoxyphenyl)acetic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:125676 2-(3,4,5-trimethoxyphenyl)acetic acid
DDSJXCGGOXKGSJ-UHFFFAOYSA-N