Feedback

 

2-(3-hydroxyphenyl)propionic acid

Image of MNXM471368
Properties
MNX_IDMNXM471368
formulaC9H9O3
charge-1
mass165.1665
referencechebi:131432
InChIKeyBYRVXROVZBYNOZ-UHFFFAOYSA-M
InChIInChI=1S/C9H10O3/c1-6(9(11)12)7-3-2-4-8(10)5-7/h2-6,10H,1H3,(H,11,12)/p-1
SMILESCC(C([O-])=O)c1cccc(O)c1

This chemical compound does not exist in my selection



Occurrences of 2-(3-hydroxyphenyl)propionic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:131432 2-(3-hydroxyphenyl)propanoic acid
2-(3-hydroxyphenyl)propionic acid
2-(m-hydroxyphenyl)propanoic acid
2-(m-hydroxyphenyl)propionic acid
3-hydroxyhydratropic acid
BYRVXROVZBYNOZ-UHFFFAOYSA-N
m-hydroxyhydratropic acid