Feedback

 

L-Argininosuccinate

Image of MNXM550
Properties
MNX_IDMNXM550
formulaC10H17N4O6
charge-1
mass289.2657
referenceseed:cpd02152
InChIKeyKDZOASGQNOPSCU-WDSKDSINSA-M
InChIInChI=1S/C10H18N4O6/c11-5(8(17)18)2-1-3-13-10(12)14-6(9(19)20)4-7(15)16/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H3,12,13,14)/p-1/t5-,6-/m0/s1
SMILES[H][C@]([NH3+])(CCCNC(=[NH2+])N[C@@]([H])(CC([O-])=O)C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-Argininosuccinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB00052
hmdb:HMDB01006
(2S)-2-{3-[(4S)-4-amino-4-carboxybutyl]carbamimidamido}butanedioic acid
Argininosuccinic acid
argininosuccinic acid
kegg:C03406 2-(Nomega-L-Arginino)succinate
L-Argininosuccinate
L-Argininosuccinic acid
L-Arginosuccinic acid
N-(L-Arginino)succinate
metacyc:L-ARGININO-SUCCINATE L-ARGININO-SUCCINATE
L-arginino-succinate
N-(L-arginino)-succinate
arginino-succinate
reactome:34575 (N(omega)-L-arginino)succinic acid
ARSUA
L-Argininosuccinate
L-Argininosuccinic acid
L-Arginosuccinic acid
N(omega)-(L-Arginino)succinate
N-(L-Arginino)succinate
seed:cpd02152 2-(Nomega-L-Arginino)succinate
L-Argininosuccinate
L-Argininosuccinic acid
L-Arginosuccinic acid
N(omega)-(L-Arginino)succinate
N-(L-Arginino)succinate
N-omega-(L-Arginino)succinate
argsuc
l-arginino-succinate
deprecated:MNXM491579
deprecated:MNXM89833