Feedback

6-Mercaptopurine ribonucleoside 5'-diphosphate

PropertiesImageOccurences in reactions
MNX_IDMNXM5568Image of MNXM5568
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC10H14N4O10P2S
charge0
mass443.99059
referencechebi:80610
InChIKeyMHJZYMCYLFGDRD-KQYNXXCUSA-N
InChIInChI=1S/C10H14N4O10P2S/c15-6-4(1-22-26(20,21)24-25(17,18)19)23-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)27/h2-4,6-7,10,15-16H,1H2,(H,20,21)(H,11,12,27)(H2,17,18,19)/t4-,6-,7-,10-/m1/s1
SMILESO=P(O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(S)ncnc32)[C@H](O)[C@@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:80610
chebi:80610
kegg.compound:C16616
keggC:C16616
6-Mercaptopurine ribonucleoside 5'-diphosphate
6-Thioinosine-5'-diphosphate
hmdb:HMDB0060660 6-Mercaptopurine ribonucleoside 5'-diphosphate
6-MPR 5'-DP
6-Mercaptopurine ribonucleoside 5'-diphosphoric acid
6-Thioinosine-5'-diphosphate
6-Thioinosine-5'-diphosphoric acid
6-thioinosine-5'-diphosphate
[({[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-sulfanyl-9H-purin-9-yl)oxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid
seed.compound:cpd16420
seedM:cpd16420
6-Thioinosine-5'-diphosphate
6-Mercaptopurine ribonucleoside 5'-diphosphate
hmdb:HMDB60660
keggC:M_C16616
seedM:M_cpd16420
secondary/obsolete/fantasy identifier