Feedback

2-chloro-3-oxoadipic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM6063Image of MNXM6063
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC6H7ClO5
charge0
mass193.9982
referencechebi:19500
InChIKeyYJYHEBUTQYISNJ-UHFFFAOYSA-N
InChIInChI=1S/C6H7ClO5/c7-5(6(11)12)3(8)1-2-4(9)10/h5H,1-2H2,(H,9,10)(H,11,12)
SMILESO=C(O)CCC(=O)C(Cl)C(=O)O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:19500
chebi:19500
2-chloro-3-oxoadipic acid
2-chloro-3-oxohexanedioic acid
envipath:...fcb03d854f4d
envipathM:...fcb03d854f4d
kegg.compound:C12836
keggC:C12836
2-Chloro-3-oxoadipate
seed.compound:cpd09315
seedM:cpd09315
2-Chloro-3-oxoadipate
2-chloro-3-oxoadipate
metacyc.compound:CPD-8827
metacycM:CPD-8827
2-chloro-3-oxoadipate
CHEBI:149587
chebi:149587
2-chloro-3-oxoadipate
2-chloro-3-keto-adipate
2-chloro-3-oxohexanedioate
chebi:31078
keggC:M_C12836
seedM:M_cpd09315
secondary/obsolete/fantasy identifier