Feedback

 

Phosphatidylethanolamine (O-18:0/0:0)

Image of MNXM618487
Properties
MNX_IDMNXM618487
formulaC5H13NO6PR
charge0
massNA
referenceslm:000098535
InChIKeyNA
InChINA
SMILES[NH3+]CCOP([O-])(=O)OCC(O)CO*

This chemical compound does not exist in my selection



Occurrences of Phosphatidylethanolamine (O-18:0/0:0) in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
slm:000098535 LPE(O-18:0/0:0)
PE(O-18:0/0:0)
Phosphatidylethanolamine (O-18:0/0:0)