Feedback

 

Phosphatidylethanolamine (P-30:0/0:0)

Image of MNXM621552
Properties
MNX_IDMNXM621552
formulaC7H15NO6PR
charge0
massNA
referenceslm:000100225
InChIKeyNA
InChINA
SMILES[NH3+]CCOP([O-])(=O)OCC(O)COC=C*

This chemical compound does not exist in my selection



Occurrences of Phosphatidylethanolamine (P-30:0/0:0) in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
slm:000100225 LPE(P-30:0/0:0)
PE(P-30:0/0:0)
Phosphatidylethanolamine (P-30:0/0:0)