Feedback

 

moronic acid

Image of MNXM62543
Properties
MNX_IDMNXM62543
formulaC30H45O3
charge-1
mass453.677
referencechebi:30815
InChIKeyUMYJVVZWBKIXQQ-QALSDZMNSA-M
InChIInChI=1S/C30H46O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h18-19,21-22H,8-17H2,1-7H3,(H,32,33)/p-1/t19-,21+,22-,27+,28-,29-,30+/m1/s1
SMILES[H][C@]12CC[C@]3([H])[C@@]4(C)CCC(=O)C(C)(C)[C@]4([H])CC[C@@]3(C)[C@]1(C)CC[C@]1(CCC(C)(C)C=C21)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of moronic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:30815 (4aS,6aR,6bR,8aR,12aR,12bR,14aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14,14a-icosahydropicene-4a-carboxylic acid
3-oxoolean-18-en-28-oic acid
UMYJVVZWBKIXQQ-QALSDZMNSA-N
moronic acid
lipidmaps:LMPR0106150002 3-oxoolean-18-en-28-oic acid
Moronic acid
lipidmaps:LMPR0106150002
metacyc:CPD-14643 3-oxoolean-18-en-28-oic acid
CPD-14643
moronate
moronic acid