Feedback

 

Mucronine B

Image of MNXM62606
Properties
MNX_IDMNXM62606
formulaC28H37N4O4
charge1
mass493.6172
referencechebi:7013
InChIKeyHBLUGHSSFJXCOA-DEYBTNLMSA-O
InChIInChI=1S/C28H36N4O4/c1-5-18(2)25-28(35)31-23(16-19-9-7-6-8-10-19)26(33)30-14-13-20-11-12-24(36-4)21(15-20)17-22(29-3)27(34)32-25/h6-15,18,22-23,25,29H,5,16-17H2,1-4H3,(H,30,33)(H,31,35)(H,32,34)/p+1/b14-13-/t18-,22-,23-,25-/m0/s1
SMILES[H][C@]1(NC(=O)[C@H](Cc2cc(ccc2OC)\C=C/NC(=O)[C@H](Cc2ccccc2)NC1=O)[NH2+]C)[C@@H](C)CC

This chemical compound does not exist in my selection



Occurrences of Mucronine B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:7013 HBLUGHSSFJXCOA-DEYBTNLMSA-N
Mucronine B
kegg:C10010
seed:cpd06900
Mucronine B
deprecated:MNXM95335