Feedback

 

multiflorin B

Image of MNXM62621
Properties
MNX_IDMNXM62621
formulaC27H29O15
charge-1
mass593.5107
referencechebi:81208
InChIKeyZCSDEGFPWXFQLB-WRHRXROUSA-M
InChIInChI=1S/C27H30O15/c1-9-23(41-27-21(36)19(34)17(32)15(8-28)40-27)20(35)22(37)26(38-9)42-25-18(33)16-13(31)6-12(30)7-14(16)39-24(25)10-2-4-11(29)5-3-10/h2-7,9,15,17,19-23,26-32,34-37H,8H2,1H3/p-1/t9-,15+,17+,19-,20-,21+,22+,23-,26-,27-/m0/s1
SMILESC[C@@H]1O[C@@H](Oc2c(oc3cc([O-])cc(O)c3c2=O)-c2ccc(O)cc2)[C@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O

This chemical compound does not exist in my selection



Occurrences of multiflorin B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:81208 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-3-yl 6-deoxy-4-O-beta-D-glucopyranosyl-alpha-L-mannopyranoside
ZCSDEGFPWXFQLB-WRHRXROUSA-N
kaempferol-3-O-alpha-L-rhamnopyranosyl-(1->4)-beta-D-glucopyranoside
multiflorin B
lipidmaps:LMPK12111858 Multiflorin B
lipidmaps:LMPK12111858
kegg:C17600
seed:cpd17720
Multiflorin B
deprecated:MNXM62622