Feedback

 

Mundulea flavanone B

Image of MNXM62634
Properties
MNX_IDMNXM62634
formulaC21H22O5
charge0
mass354.3964
referencelipidmaps:LMPK12140567
InChIKeyOWTSKJPRWFIYHU-SFHVURJKSA-N
InChIInChI=1S/C21H22O5/c1-12(2)4-9-15-19(25-3)11-17(24)20-16(23)10-18(26-21(15)20)13-5-7-14(22)8-6-13/h4-8,11,18,22,24H,9-10H2,1-3H3/t18-/m0/s1
SMILESCOc1cc(O)c2C(=O)C[C@H](Oc2c1CC=C(C)C)c1ccc(O)cc1

This chemical compound does not exist in my selection



Occurrences of Mundulea flavanone B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
lipidmaps:LMPK12140567 7-Methyl-4'-hydroxyglabranin
7-O-Methyl-8-prenylnaringenin
Mundulea flavanone B
lipidmaps:LMPK12140567