Feedback

 

mupirocin

Image of MNXM62649
Properties
MNX_IDMNXM62649
formulaC26H43O9
charge-1
mass499.6148
referencechebi:7025
InChIKeyMINDHVHHQZYEEK-HBBNESRFSA-M
InChIInChI=1S/C26H44O9/c1-16(13-23(30)33-11-9-7-5-4-6-8-10-22(28)29)12-20-25(32)24(31)19(15-34-20)14-21-26(35-21)17(2)18(3)27/h13,17-21,24-27,31-32H,4-12,14-15H2,1-3H3,(H,28,29)/p-1/b16-13+/t17-,18-,19-,20-,21-,24+,25-,26-/m0/s1
SMILES[H][C@@]1(C[C@H]2CO[C@@H](C\C(C)=C\C(=O)OCCCCCCCCC([O-])=O)[C@H](O)[C@@H]2O)O[C@@]1([H])[C@@H](C)[C@H](C)O

This chemical compound does not exist in my selection



Occurrences of mupirocin in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:44038
chebi:7025
9-({(2E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-({(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl}methyl)tetrahydro-2H-pyran-2-yl]-3-methylbut-2-enoyl}oxy)nonanoic acid
Bactroban
Centany
MINDHVHHQZYEEK-HBBNESRFSA-N
Pseudomonic acid A
mupirocin
mupirocina
mupirocine
mupirocinum
chebi:94519 9-[4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]-2-oxiranyl]methyl]-2-oxanyl]-3-methyl-1-oxobut-2-enoxy]nonanoic acid
MINDHVHHQZYEEK-OYXVVHJOSA-N
hmdb:HMDB14554 9-{[(2E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-{[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl}oxan-2-yl]-3-methylbut-2-enoyl]oxy}nonanoic acid
Mupirocin
mupirocin
kegg:C11758
kegg:D01076
Bactroban (TN)
Centany (TN)
MUP
Mupirocin
Mupirocin (USP/INN)
seed:cpd08563 Mupirocin
deprecated:MNXM95336