Feedback

 

Mycalamide B

Image of MNXM62681
Properties
MNX_IDMNXM62681
formulaC25H43NO10
charge0
mass517.6096
referencechebi:80858
InChIKeyAAABMNXUOFPYQK-WMBKCNCTSA-N
InChIInChI=1S/C25H43NO10/c1-13-10-25(32-8,36-15(3)14(13)2)20(28)22(29)26-23-19-18(33-12-34-23)21(31-7)24(4,5)17(35-19)9-16(11-27)30-6/h14-21,23,27-28H,1,9-12H2,2-8H3,(H,26,29)/t14-,15-,16+,17?,18+,19+,20-,21-,23+,25-/m1/s1
SMILES[H][C@]12OCO[C@H](NC(=O)[C@@H](O)[C@]3(CC(=C)[C@@H](C)[C@@H](C)O3)OC)[C@@]1([H])OC(C[C@@H](CO)OC)C(C)(C)[C@@H]2OC

This chemical compound does not exist in my selection



Occurrences of Mycalamide B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:80858 AAABMNXUOFPYQK-WMBKCNCTSA-N
Mycalamide B
kegg:C17009
seed:cpd17277
Mycalamide B