Feedback

 

Mycalolide B

Image of MNXM62682
Properties
MNX_IDMNXM62682
formulaC52H74N4O17
charge0
mass1027.1606
referenceseed:cpd19215
InChIKeyZYDMLFOHENLMIN-BPCLLOJHSA-N
InChIInChI=1S/C52H74N4O17/c1-30(19-20-42(73-52(62)45(66-11)28-63-8)34(5)48(71-35(6)58)31(2)21-22-56(7)29-57)43(65-10)24-44-33(4)41(64-9)17-14-18-46-53-38(26-68-46)50-55-39(27-70-50)51-54-37(25-69-51)49(67-12)32(3)40(60)16-13-15-36(59)23-47(61)72-44/h13-14,16,18,21-22,25-27,29-34,36,41-45,48-49,59H,15,17,19-20,23-24,28H2,1-12H3/b16-13?,18-14?,22-21+/t30-,31+,32-,33+,34-,36-,41-,42+,43-,44-,45+,48+,49-/m0/s1
SMILES[H]\C(=C(\[H])[C@@]([H])(C)[C@@]([H])(OC(C)=O)[C@@]([H])(C)[C@@]([H])(CC[C@]([H])(C)[C@]([H])(C[C@]1([H])OC(=O)C[C@@]([H])(O)CC([H])=C([H])C(=O)[C@]([H])(C)[C@]([H])(OC)c2coc(n2)-c2coc(n2)-c2coc(n2)C([H])=C([H])C[C@]([H])(OC)[C@@]1([H])C)OC)OC(=O)[C@@]([H])(COC)OC)N(C)C=O

This chemical compound does not exist in my selection



Occurrences of Mycalolide B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
kegg:C16902
seed:cpd19215
Mycalolide B