Feedback

 

mycobactin M

Image of MNXM62697
Properties
MNX_IDMNXM62697
formulaC27H37N5O10
charge0
mass591.6102
referenceseed:cpd23220
InChIKeyNGQYHMUFXKSYFU-UHFFFAOYSA-N
InChIInChI=1S/C27H37N5O10/c33-17-31(39)13-6-1-2-10-20(29-24(36)21-16-42-25(30-21)18-8-3-4-11-22(18)34)27(38)41-15-12-23(35)28-19-9-5-7-14-32(40)26(19)37/h3-4,8,11,17,19-21,30,39-40H,1-2,5-7,9-10,12-16H2,(H,28,35)(H,29,36)
SMILESON(CCCCCC(NC(=O)C1COC(N1)=C1C=CC=CC1=O)C(=O)OCCC(=O)NC1CCCCN(O)C1=O)C=O

This chemical compound does not exist in my selection



Occurrences of mycobactin M in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
metacyc:CPD-12069 CPD-12069
mycobactin M
seed:cpd23220 mycobactin M