Feedback

 

Myrigalon B

Image of MNXM62830
Properties
MNX_IDMNXM62830
formulaC18H20O4
charge0
mass300.349
referencelipidmaps:LMPK12120490
InChIKeySGSWJLOWQDDBPP-UHFFFAOYSA-N
InChIInChI=1S/C18H20O4/c1-11-16(20)15(17(21)12(2)18(11)22-3)14(19)10-9-13-7-5-4-6-8-13/h4-8,20-21H,9-10H2,1-3H3
SMILESCOc1c(C)c(O)c(C(=O)CCc2ccccc2)c(O)c1C

This chemical compound does not exist in my selection



Occurrences of Myrigalon B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB37246 1-(2,6-dihydroxy-4-methoxy-3,5-dimethylphenyl)-3-phenylpropan-1-one
Myrigalon B
myrigalon B
lipidmaps:LMPK12120490 Myrigalon B
lipidmaps:LMPK12120490