Feedback

 

Myrigalone H

Image of MNXM62831
Properties
MNX_IDMNXM62831
formulaC17H18O4
charge0
mass286.3224
referencelipidmaps:LMPK12120492
InChIKeyZDJYWPQCNAPESX-UHFFFAOYSA-N
InChIInChI=1S/C17H18O4/c1-11-14(19)10-15(21-2)16(17(11)20)13(18)9-8-12-6-4-3-5-7-12/h3-7,10,19-20H,8-9H2,1-2H3
SMILESCOc1cc(O)c(C)c(O)c1C(=O)CCc1ccccc1

This chemical compound does not exist in my selection



Occurrences of Myrigalone H in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB41169 1-(2,4-dihydroxy-6-methoxy-3-methylphenyl)-3-phenylpropan-1-one
Myrigalone H
myrigalone H
lipidmaps:LMPK12120492 2',4'-Dihydroxy-6'-methoxy-3'-methyldihydrochalcone
Myrigalone H
lipidmaps:LMPK12120492