Feedback

 

Myxalamid B

Image of MNXM62854
Properties
MNX_IDMNXM62854
formulaC25H39NO3
charge0
mass401.5821
referencechebi:31873
InChIKeyQQZJCNSHAVQKIC-DDKJXSSXSA-N
InChIInChI=1S/C25H39NO3/c1-18(2)15-21(5)24(28)22(6)16-19(3)13-11-9-8-10-12-14-20(4)25(29)26-23(7)17-27/h8-16,18,22-24,27-28H,17H2,1-7H3,(H,26,29)/b9-8-,12-10+,13-11+,19-16+,20-14+,21-15+/t22-,23+,24+/m1/s1
SMILESCC(C)\C=C(/C)[C@H](O)[C@H](C)\C=C(/C)\C=C\C=C/C=C/C=C(C)C(=O)N[C@@H](C)CO

This chemical compound does not exist in my selection



Occurrences of Myxalamid B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:31873 Myxalamid B
QQZJCNSHAVQKIC-DDKJXSSXSA-N
kegg:C12159
seed:cpd08940
Myxalamid B