Feedback

 

myxochelin B

Image of MNXM62860
Properties
MNX_IDMNXM62860
formulaC20H26N3O6
charge1
mass404.4364
referencechebi:7061
InChIKeyQTARRKFUMCSVOF-LBPRGKRZSA-O
InChIInChI=1S/C20H25N3O6/c21-11-12(23-20(29)14-7-4-9-16(25)18(14)27)5-1-2-10-22-19(28)13-6-3-8-15(24)17(13)26/h3-4,6-9,12,24-27H,1-2,5,10-11,21H2,(H,22,28)(H,23,29)/p+1/t12-/m0/s1
SMILES[NH3+]C[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1cccc(O)c1O

This chemical compound does not exist in my selection



Occurrences of myxochelin B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:31878
chebi:7061
N-{(2S)-1-amino-6-[(2,3-dihydroxybenzoyl)amino]hexan-2-yl}-2,3-dihydroxybenzamide
QTARRKFUMCSVOF-LBPRGKRZSA-N
myxochelin B
kegg:C12221
seed:cpd09000
Myxochelin B
deprecated:MNXM95347